Salts and Inorganics
A variety of inorganic salts and elemental metals that can be used for large-scale, industrial purposes and everyday laboratory applications. Products are available in a range of chemical compositions, quantities, purities, and reagent grades.
Inorganics are elements and compounds, including carbon monoxide, carbon dioxide, carbonates, cyanides, cyanates, and carbides, that do not contain a carbon-hydrogen bond. This group also includes carbon allotropes such as graphite and graphene.
Because organic chemicals include only those that contain carbon atoms bonded to hydrogen atoms, the majority of elements in the periodic table and most substances in the material world are considered to be inorganic chemicals.
Filtered Search Results
Sodium tellurite(IV), 99.5% (metals basis)
CAS: 10102-20-2 Molecular Formula: H10Na2O9Te Molecular Weight (g/mol): 327.65 MDL Number: MFCD00036141 InChI Key: OVBVNEXDNNHXIU-UHFFFAOYSA-L Synonym: sodium tellurite,disodium tellurite,sodium tellurate iv,disodium trioxotellurate,unii-0bb57la23y,tellurous acid, disodium salt,sodium tellurite iv,telluric acid h2teo3 , disodium salt,telluric acid, disodium salt PubChem CID: 24935 IUPAC Name: disodium;tellurite SMILES: O.O.O.O.O.[Na+].[Na+].[O-][Te]([O-])(=O)=O
| PubChem CID | 24935 |
|---|---|
| CAS | 10102-20-2 |
| Molecular Weight (g/mol) | 327.65 |
| MDL Number | MFCD00036141 |
| SMILES | O.O.O.O.O.[Na+].[Na+].[O-][Te]([O-])(=O)=O |
| Synonym | sodium tellurite,disodium tellurite,sodium tellurate iv,disodium trioxotellurate,unii-0bb57la23y,tellurous acid, disodium salt,sodium tellurite iv,telluric acid h2teo3 , disodium salt,telluric acid, disodium salt |
| IUPAC Name | disodium;tellurite |
| InChI Key | OVBVNEXDNNHXIU-UHFFFAOYSA-L |
| Molecular Formula | H10Na2O9Te |
Silver nitrate solution, 0.1N, TitriPUR™, MilliporeSigma™
CAS: 7761-88-8 Molecular Formula: AgNO3 Molecular Weight (g/mol): 169.87 MDL Number: MFCD00003414 InChI Key: SQGYOTSLMSWVJD-UHFFFAOYSA-N Synonym: silver nitrate,silvernitrate,lunar caustic,silbernitrat,argenti nitras,nitrate d'argent,nitric acid silver i salt,silver mononitrate,silver i nitrate,argerol PubChem CID: 24470 ChEBI: CHEBI:32130 IUPAC Name: silver(1+) nitrate SMILES: [Ag+].[O-][N+]([O-])=O
| PubChem CID | 24470 |
|---|---|
| CAS | 7761-88-8 |
| Molecular Weight (g/mol) | 169.87 |
| ChEBI | CHEBI:32130 |
| MDL Number | MFCD00003414 |
| SMILES | [Ag+].[O-][N+]([O-])=O |
| Synonym | silver nitrate,silvernitrate,lunar caustic,silbernitrat,argenti nitras,nitrate d'argent,nitric acid silver i salt,silver mononitrate,silver i nitrate,argerol |
| IUPAC Name | silver(1+) nitrate |
| InChI Key | SQGYOTSLMSWVJD-UHFFFAOYSA-N |
| Molecular Formula | AgNO3 |
| CAS | 10035-04-8 |
|---|---|
| Molecular Formula | CaCl2. 2H2O |
Platinum powder, -200 mesh, 99.98% (metals basis)
CAS: 6-4-7440 Molecular Formula: Pt Molecular Weight (g/mol): 195.08 MDL Number: MFCD00011179 InChI Key: BASFCYQUMIYNBI-UHFFFAOYSA-N Synonym: black,platin,sponge,platinum, metal,platinum, elemental,platine,platino,metal,platin german,iv ion PubChem CID: 23939 ChEBI: CHEBI:33400 IUPAC Name: platinum SMILES: [Pt]
| PubChem CID | 23939 |
|---|---|
| CAS | 6-4-7440 |
| Molecular Weight (g/mol) | 195.08 |
| ChEBI | CHEBI:33400 |
| MDL Number | MFCD00011179 |
| SMILES | [Pt] |
| Synonym | black,platin,sponge,platinum, metal,platinum, elemental,platine,platino,metal,platin german,iv ion |
| IUPAC Name | platinum |
| InChI Key | BASFCYQUMIYNBI-UHFFFAOYSA-N |
| Molecular Formula | Pt |
Ytterbium pieces, sublimed, 99.9% (REO)
CAS: 7440-64-4 Molecular Formula: Yb Molecular Weight (g/mol): 173.05 MDL Number: MFCD00011286 InChI Key: NAWDYIZEMPQZHO-UHFFFAOYSA-N Synonym: unii-mnq4o4wsi1,hydride,mnq4o4wsi1,foil, 3n,yterbio,ingot,powder,ii ion,chips, 3n,ingot, 3n PubChem CID: 23992 ChEBI: CHEBI:33381 IUPAC Name: ytterbium SMILES: [Yb]
| PubChem CID | 23992 |
|---|---|
| CAS | 7440-64-4 |
| Molecular Weight (g/mol) | 173.05 |
| ChEBI | CHEBI:33381 |
| MDL Number | MFCD00011286 |
| SMILES | [Yb] |
| Synonym | unii-mnq4o4wsi1,hydride,mnq4o4wsi1,foil, 3n,yterbio,ingot,powder,ii ion,chips, 3n,ingot, 3n |
| IUPAC Name | ytterbium |
| InChI Key | NAWDYIZEMPQZHO-UHFFFAOYSA-N |
| Molecular Formula | Yb |
Boron phosphate
CAS: 13308-51-5 Molecular Formula: BO4P Molecular Weight (g/mol): 105.78 MDL Number: MFCD00011318 InChI Key: RKVCQBPDVHFKCU-UHFFFAOYSA-N Synonym: boron phosphate,boron orthophosphate,boron phosphate b po4,2,4,5-trioxa-1-phospha-3-borabicyclo 1.1.1 pentane 1-oxide,2,4,5-trioxa-1??-phospha-3-borabicyclo 1.1.1 pentan-1-one,borophosphoric acid,boron iii phosphate,boron phosphate hydrate,boronphosphate b po4,boron phosphate 100g PubChem CID: 83329 IUPAC Name: 2,4,5-trioxa-1$l^{5}-phospha-3-borabicyclo[1.1.1]pentane 1-oxide SMILES: B12OP(=O)(O1)O2
| PubChem CID | 83329 |
|---|---|
| CAS | 13308-51-5 |
| Molecular Weight (g/mol) | 105.78 |
| MDL Number | MFCD00011318 |
| SMILES | B12OP(=O)(O1)O2 |
| Synonym | boron phosphate,boron orthophosphate,boron phosphate b po4,2,4,5-trioxa-1-phospha-3-borabicyclo 1.1.1 pentane 1-oxide,2,4,5-trioxa-1??-phospha-3-borabicyclo 1.1.1 pentan-1-one,borophosphoric acid,boron iii phosphate,boron phosphate hydrate,boronphosphate b po4,boron phosphate 100g |
| IUPAC Name | 2,4,5-trioxa-1$l^{5}-phospha-3-borabicyclo[1.1.1]pentane 1-oxide |
| InChI Key | RKVCQBPDVHFKCU-UHFFFAOYSA-N |
| Molecular Formula | BO4P |
Barium hydroxide monohydrate, 95%
CAS: 22326-55-2 Molecular Formula: BaH4O3 Molecular Weight (g/mol): 189.356 MDL Number: MFCD00149151 InChI Key: GKQTUHKAQKWLIN-UHFFFAOYSA-L Synonym: barium hydroxide monohydrate,barium hydroxide ba oh 2 , monohydrate,bariumdiol hydrate,barium hydroxide hydrate trace metals basis,barium hydroxide monohydrate, purum p.a t PubChem CID: 16211219 IUPAC Name: barium(2+);dihydroxide;hydrate SMILES: O.[OH-].[OH-].[Ba+2]
| PubChem CID | 16211219 |
|---|---|
| CAS | 22326-55-2 |
| Molecular Weight (g/mol) | 189.356 |
| MDL Number | MFCD00149151 |
| SMILES | O.[OH-].[OH-].[Ba+2] |
| Synonym | barium hydroxide monohydrate,barium hydroxide ba oh 2 , monohydrate,bariumdiol hydrate,barium hydroxide hydrate trace metals basis,barium hydroxide monohydrate, purum p.a t |
| IUPAC Name | barium(2+);dihydroxide;hydrate |
| InChI Key | GKQTUHKAQKWLIN-UHFFFAOYSA-L |
| Molecular Formula | BaH4O3 |
Tellurium(IV) chloride, 99.9% (metals basis)
CAS: 10026-07-0 Molecular Formula: Cl4Te Molecular Weight (g/mol): 269.4 MDL Number: MFCD00011262 InChI Key: SWLJJEFSPJCUBD-UHFFFAOYSA-N Synonym: tellurium tetrachloride,telluric chloride,tellurium chloride,tetrachlorotellurium,tellurium iv chloride,tellurium chloride tecl4 , t-4,unii-dny2r5498h,tellurium chloride, t-4,telluricchloride,tecl4 PubChem CID: 61443 SMILES: Cl[Te](Cl)(Cl)Cl
| PubChem CID | 61443 |
|---|---|
| CAS | 10026-07-0 |
| Molecular Weight (g/mol) | 269.4 |
| MDL Number | MFCD00011262 |
| SMILES | Cl[Te](Cl)(Cl)Cl |
| Synonym | tellurium tetrachloride,telluric chloride,tellurium chloride,tetrachlorotellurium,tellurium iv chloride,tellurium chloride tecl4 , t-4,unii-dny2r5498h,tellurium chloride, t-4,telluricchloride,tecl4 |
| InChI Key | SWLJJEFSPJCUBD-UHFFFAOYSA-N |
| Molecular Formula | Cl4Te |
Cadmium nitrate tetrahydrate, Puratronic™, 99.999% (metals basis)
CAS: 10022-68-1 Molecular Formula: CdH2N2O6 Molecular Weight (g/mol): 238.44 MDL Number: MFCD00149626 InChI Key: IZIPRBSCGMISKX-UHFFFAOYSA-N Synonym: cadmium nitrate tetrahydrate,nitric acid, cadmium salt, tetrahydrate,cd no3 2.4h2o,acmc-20aljb,ksc174c1h,cadmium nitrate-water 1/4,cadmiumnitratetetrahydrate,cadmium ii nitrate tetrahydrate,nitric acid, cadmium salt tetrahydrate PubChem CID: 56924536 ChEBI: CHEBI:86156 SMILES: [Cd++].O[N+]([O-])=O.O[N+]([O-])=O
| PubChem CID | 56924536 |
|---|---|
| CAS | 10022-68-1 |
| Molecular Weight (g/mol) | 238.44 |
| ChEBI | CHEBI:86156 |
| MDL Number | MFCD00149626 |
| SMILES | [Cd++].O[N+]([O-])=O.O[N+]([O-])=O |
| Synonym | cadmium nitrate tetrahydrate,nitric acid, cadmium salt, tetrahydrate,cd no3 2.4h2o,acmc-20aljb,ksc174c1h,cadmium nitrate-water 1/4,cadmiumnitratetetrahydrate,cadmium ii nitrate tetrahydrate,nitric acid, cadmium salt tetrahydrate |
| InChI Key | IZIPRBSCGMISKX-UHFFFAOYSA-N |
| Molecular Formula | CdH2N2O6 |
tert-Butyldimethylchlorosilane, 97%
CAS: 18162-48-6 Molecular Formula: C6H15ClSi Molecular Weight (g/mol): 150.721 MDL Number: MFCD00000501 InChI Key: BCNZYOJHNLTNEZ-UHFFFAOYSA-N Synonym: tert-butyldimethylsilyl chloride,tert-butyldimethylchlorosilane,t-butyldimethylchlorosilane,tert-butylchlorodimethylsilane,tbdms chloride,tert-butyl chloro dimethylsilane,chloro-tert-butyldimethylsilane,silane, chloro 1,1-dimethylethyl dimethyl,tbscl,t-butyldimethylsilyl chloride PubChem CID: 28928 ChEBI: CHEBI:85071 IUPAC Name: tert-butyl-chloro-dimethylsilane SMILES: CC(C)(C)[Si](C)(C)Cl
| PubChem CID | 28928 |
|---|---|
| CAS | 18162-48-6 |
| Molecular Weight (g/mol) | 150.721 |
| ChEBI | CHEBI:85071 |
| MDL Number | MFCD00000501 |
| SMILES | CC(C)(C)[Si](C)(C)Cl |
| Synonym | tert-butyldimethylsilyl chloride,tert-butyldimethylchlorosilane,t-butyldimethylchlorosilane,tert-butylchlorodimethylsilane,tbdms chloride,tert-butyl chloro dimethylsilane,chloro-tert-butyldimethylsilane,silane, chloro 1,1-dimethylethyl dimethyl,tbscl,t-butyldimethylsilyl chloride |
| IUPAC Name | tert-butyl-chloro-dimethylsilane |
| InChI Key | BCNZYOJHNLTNEZ-UHFFFAOYSA-N |
| Molecular Formula | C6H15ClSi |
Lead(II) oxide, Puratronic™, 99.999% (metals basis)
CAS: 1317-36-8 Molecular Formula: OPb Molecular Weight (g/mol): 223.20 MDL Number: MFCD00011164 InChI Key: YEXPOXQUZXUXJW-UHFFFAOYSA-N Synonym: lead monoxide,lead ii oxide,lead oxide pbo,massicot,massicotite,lead monooxide,lead protoxide,plumbous oxide,litharge pure,lead oxide yellow PubChem CID: 14827 IUPAC Name: oxolead SMILES: O=[Pb]
| PubChem CID | 14827 |
|---|---|
| CAS | 1317-36-8 |
| Molecular Weight (g/mol) | 223.20 |
| MDL Number | MFCD00011164 |
| SMILES | O=[Pb] |
| Synonym | lead monoxide,lead ii oxide,lead oxide pbo,massicot,massicotite,lead monooxide,lead protoxide,plumbous oxide,litharge pure,lead oxide yellow |
| IUPAC Name | oxolead |
| InChI Key | YEXPOXQUZXUXJW-UHFFFAOYSA-N |
| Molecular Formula | OPb |
Copper(II) nitrate hydrate, Puratronic™, 99.999% (metals basis)
CAS: 13778-31-9 Molecular Formula: CuN2O6 Molecular Weight (g/mol): 187.55 MDL Number: MFCD00149669 InChI Key: XTVVROIMIGLXTD-UHFFFAOYSA-N Synonym: copper ii nitrate hydrate,copper nitrate hydrate,acmc-20aldm,cupric nitrate hydrate,cu.2no3.h2o,copper 2+ ion hydrate dinitrate,copper 2+ hydrate dinitrate,copper ii nitrate hydrate, puratronic,copper 2+ nitrate-water 1/2/1,nitric acid, copper 2+ salt, hydrate 8ci,9ci PubChem CID: 15303652 SMILES: [Cu++].[O-][N+]([O-])=O.[O-][N+]([O-])=O
| PubChem CID | 15303652 |
|---|---|
| CAS | 13778-31-9 |
| Molecular Weight (g/mol) | 187.55 |
| MDL Number | MFCD00149669 |
| SMILES | [Cu++].[O-][N+]([O-])=O.[O-][N+]([O-])=O |
| Synonym | copper ii nitrate hydrate,copper nitrate hydrate,acmc-20aldm,cupric nitrate hydrate,cu.2no3.h2o,copper 2+ ion hydrate dinitrate,copper 2+ hydrate dinitrate,copper ii nitrate hydrate, puratronic,copper 2+ nitrate-water 1/2/1,nitric acid, copper 2+ salt, hydrate 8ci,9ci |
| InChI Key | XTVVROIMIGLXTD-UHFFFAOYSA-N |
| Molecular Formula | CuN2O6 |
Tantalum nitride, 99.5% (metals basis)
CAS: 12033-62-4 Molecular Formula: NTa Molecular Weight (g/mol): 194.955 MDL Number: MFCD00049568 InChI Key: MZLGASXMSKOWSE-UHFFFAOYSA-N Synonym: tantalum nitride,tantalum nitride tan,tantalum mononitride,tantalum nitride trace metals basis 10g PubChem CID: 82832 IUPAC Name: azanylidynetantalum SMILES: N#[Ta]
| PubChem CID | 82832 |
|---|---|
| CAS | 12033-62-4 |
| Molecular Weight (g/mol) | 194.955 |
| MDL Number | MFCD00049568 |
| SMILES | N#[Ta] |
| Synonym | tantalum nitride,tantalum nitride tan,tantalum mononitride,tantalum nitride trace metals basis 10g |
| IUPAC Name | azanylidynetantalum |
| InChI Key | MZLGASXMSKOWSE-UHFFFAOYSA-N |
| Molecular Formula | NTa |
Gadolinium(III) nitride, 99.5% (REO)
CAS: 25764-15-2 Molecular Formula: GdN Molecular Weight (g/mol): 171.26 MDL Number: MFCD00049943 InChI Key: FLATXDRVRRDFBZ-UHFFFAOYSA-N Synonym: gadolinium nitride,gadolinium iii nitride,gadoliniumylidyneamine PubChem CID: 117632 IUPAC Name: azanylidynegadolinium SMILES: N#[Gd]
| PubChem CID | 117632 |
|---|---|
| CAS | 25764-15-2 |
| Molecular Weight (g/mol) | 171.26 |
| MDL Number | MFCD00049943 |
| SMILES | N#[Gd] |
| Synonym | gadolinium nitride,gadolinium iii nitride,gadoliniumylidyneamine |
| IUPAC Name | azanylidynegadolinium |
| InChI Key | FLATXDRVRRDFBZ-UHFFFAOYSA-N |
| Molecular Formula | GdN |
Titanium nitride, 99.7% (metals basis)
CAS: 25583-20-4 Molecular Formula: NTi Molecular Weight (g/mol): 61.87 MDL Number: MFCD00049596 InChI Key: NRTOMJZYCJJWKI-UHFFFAOYSA-N Synonym: titanium nitride,titanium nitride tin,nitridotitanium,unii-6rw464feff,titannitrid,titaniumylidyneamine,titanium mononitride,titanium nitride, <3 mum,6rw464feff,titanium nitride tin grade a PubChem CID: 93091 IUPAC Name: azanylidynetitanium SMILES: N#[Ti]
| PubChem CID | 93091 |
|---|---|
| CAS | 25583-20-4 |
| Molecular Weight (g/mol) | 61.87 |
| MDL Number | MFCD00049596 |
| SMILES | N#[Ti] |
| Synonym | titanium nitride,titanium nitride tin,nitridotitanium,unii-6rw464feff,titannitrid,titaniumylidyneamine,titanium mononitride,titanium nitride, <3 mum,6rw464feff,titanium nitride tin grade a |
| IUPAC Name | azanylidynetitanium |
| InChI Key | NRTOMJZYCJJWKI-UHFFFAOYSA-N |
| Molecular Formula | NTi |